- 2-CYANOBENZOIC ACID
-
- $10.00 / 1KG
-
2026-01-05
- CAS:3839-22-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- 2-CYANOBENZOIC ACID
-
- $1.00 / 1KG
-
2024-07-17
- CAS:3839-22-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
- 2-CYANOBENZOIC ACID
-
- $8.80 / 1KG
-
2019-07-14
- CAS:3839-22-3
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 100kg
|
| | 2-CYANOBENZOIC ACID Basic information |
| | 2-CYANOBENZOIC ACID Chemical Properties |
| Melting point | 212 °C (lit.) | | Boiling point | 341.9±25.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Liquid or Low Melting Solid | | pka | pK1:3.14 (25°C) | | color | Clear colorless to light yellow or white to pale yellow | | InChI | InChI=1S/C8H5NO2/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,(H,10,11) | | InChIKey | DTNSDCJFTHMDAK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1C#N | | CAS DataBase Reference | 3839-22-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37/39-36 | | RIDADR | 3439 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids |
| | 2-CYANOBENZOIC ACID Usage And Synthesis |
| Chemical Properties | Off-white needles | | Uses | 2-Cyanobenzoic acid has been used as reactant in the synthesis of T-box riboswitch antiterminator RNA-binding oxazolidinone derivatives, Benzoate modified β-cyclodextrin derivatives and Pyrrolo[1,2-f]triazines for use as JAK2 inhibitors. As a reactant involved in decarboxylation, decarboxylative halogenation and protodecarboxylation. | | Uses | 2-Cyanobenzoic acid may be used to synthesize phthalamidine. | | General Description | 2-Cyanobenzoic acid can be prepared from phthalic anhydride. Mass spectrophotometry, NMR, IR are extremely useful techniques to determine the ring-chain tautomeric equilibrium of 2-cyanobenzoic acid in all three phases. The standard (p° = 0.1MPa) molar enthalpy of formation of 2-cyanobenzoic acid is -(150.7 ± 2.0) kJ.mol-1. |
| | 2-CYANOBENZOIC ACID Preparation Products And Raw materials |
|