|
| Phenyl (trifluoromethyl) sulfone Basic information |
Product Name: | Phenyl (trifluoromethyl) sulfone | Synonyms: | (Trifluoromethyl) phenyl sulfone;Phenyl (trifluoromethyl) sulfone;Trifluoromethyl phenyl sulfone;(TrifluoroMethane)sulfonylbenzene;[(Trifluoromethyl)sulphonyl]benzene;Phenyl trifluoromethyl sulphone;((Trifluoromethyl)sulfonyl)benzene;Benzene, [(trifluoromethyl)sulfonyl]- | CAS: | 426-58-4 | MF: | C7H5F3O2S | MW: | 210.17 | EINECS: | | Product Categories: | | Mol File: | 426-58-4.mol |  |
| Phenyl (trifluoromethyl) sulfone Chemical Properties |
Boiling point | 203°C(lit.) | density | 1.423±0.06 g/cm3(Predicted) | refractive index | 1.4620 to 1.4660 | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | form | clear liquid | color | Colorless to Almost colorless | InChI | InChI=1S/C7H5F3O2S/c8-7(9,10)13(11,12)6-4-2-1-3-5-6/h1-5H | InChIKey | UPGBQYFXKAKWQC-UHFFFAOYSA-N | SMILES | C1(S(C(F)(F)F)(=O)=O)=CC=CC=C1 |
| Phenyl (trifluoromethyl) sulfone Usage And Synthesis |
| Phenyl (trifluoromethyl) sulfone Preparation Products And Raw materials |
|