|
|
| | 2-(Trifluoromethyl)benzenesulfonyl chloride Basic information |
| | 2-(Trifluoromethyl)benzenesulfonyl chloride Chemical Properties |
| Melting point | 25°C | | Boiling point | 133-135 °C14 mm Hg(lit.) | | density | 1.585 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.503(lit.) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.585 | | Sensitive | Moisture Sensitive | | BRN | 2651854 | | InChI | InChI=1S/C7H4ClF3O2S/c8-14(12,13)6-4-2-1-3-5(6)7(9,10)11/h1-4H | | InChIKey | ZIZGWNOAHUCACM-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=CC=C1C(F)(F)F | | CAS DataBase Reference | 776-04-5(CAS DataBase Reference) | | NIST Chemistry Reference | o-Trifluoromethylbenzenesulfonyl chloride(776-04-5) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 23-26-27-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 2-(Trifluoromethyl)benzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid | | Uses | 2-(Trifluoromethyl)benzenesulfonyl chloride is an ortho-substituted benzenesulfonyl chloride. | | General Description | 2-(Trifluoromethyl)benzenesulfonyl chloride is an ortho-substituted benzenesulfonyl chloride. |
| | 2-(Trifluoromethyl)benzenesulfonyl chloride Preparation Products And Raw materials |
|