| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | Dimethyl-1,2,4,5-tetrazine Basic information | | Application |
| Product Name: | Dimethyl-1,2,4,5-tetrazine | | Synonyms: | Dimethyl-1,2,4,5-tetrazine;Dimethyl-s-tetrazine;1,2,4,5-Tetrazine, 3,6-dimethyl-;3,6-DIMETHYL-1,2,4,5-TETRAAZINE;3,6-Dimethyl-1,2,4,5-tetrazine | | CAS: | 1558-23-2 | | MF: | C4H6N4 | | MW: | 110.12 | | EINECS: | | | Product Categories: | | | Mol File: | 1558-23-2.mol |  |
| | Dimethyl-1,2,4,5-tetrazine Chemical Properties |
| Melting point | 74 °C (sublm) | | Boiling point | 262.1±23.0 °C(Predicted) | | density | 1.160±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 2.37±0.10(Predicted) | | Appearance | Purple to purplish red Solid | | InChI | InChI=1S/C4H6N4/c1-3-5-7-4(2)8-6-3/h1-2H3 | | InChIKey | DGLYTMLIGRQDPE-UHFFFAOYSA-N | | SMILES | N1C(C)=NN=C(C)N=1 |
| | Dimethyl-1,2,4,5-tetrazine Usage And Synthesis |
| Application | 3,6-Dimethyl-1,2,4,5-tetraazine is widely used in cycloaddition reactions and can undergo addition reactions with a variety of dienophiles. |
| | Dimethyl-1,2,4,5-tetrazine Preparation Products And Raw materials |
|