|
|
| | 3-Methyl-1H-pyrazole-4-carboxylic acid Basic information |
| | 3-Methyl-1H-pyrazole-4-carboxylic acid Chemical Properties |
| Melting point | 225-230 °C (dec.) (lit.) | | Boiling point | 384.2±22.0 °C(Predicted) | | density | 1.404±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 14.56±0.50(Predicted) | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C5H6N2O2/c1-3-4(5(8)9)2-6-7-3/h2H,1H3,(H,6,7)(H,8,9) | | InChIKey | HLYYXPDTFLUERX-UHFFFAOYSA-N | | SMILES | N1C=C(C(O)=O)C(C)=N1 | | CAS DataBase Reference | 40704-11-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids |
| | 3-Methyl-1H-pyrazole-4-carboxylic acid Usage And Synthesis |
| Uses | 3-Methyl-1h-pyrazole-4-carboxylic Acid is a reactant used in the characterization of MOFs with crystal vacancies introduced by removing quarter of metal ions and half of linkers. | | Definition | ChEBI: 3-methyl-pyrazole-4-carboxylic acid is a member of the class of pyrazoles that is 1H-pyrazole with methyl and carboxylic acid group substituents at positions 3 and 4 respectively. It has a role as a metabolite. It is a member of pyrazoles and a monocarboxylic acid. It derives from a hydride of a 1H-pyrazole. |
| | 3-Methyl-1H-pyrazole-4-carboxylic acid Preparation Products And Raw materials |
|