|
|
| | PENTAFLUOROBENZENESULFONYL CHLORIDE Basic information |
| Product Name: | PENTAFLUOROBENZENESULFONYL CHLORIDE | | Synonyms: | Benzene,1-chlorosulphonyl-2,3,4,5,6-pentafluoro-;Benzenesulfonyl chloride, pentafluoro-;Pentafluorophenylsulfonyl chloride;(4R)-N-(2-aminoethyl)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide;PENTAFLUOROBENZENESULFONYL CHLORIDE;PENTAFLUOROBENZENESULPHONYL CHLORIDE;F05480 2,3,4,5,6-Pentafluorobenzenesulfonyl chloride;PENTAFLUOROBENZENESULFONYL CHLORIDE 99% | | CAS: | 832-53-1 | | MF: | C6ClF5O2S | | MW: | 266.57 | | EINECS: | 212-620-0 | | Product Categories: | Aromatic Halides (substituted);Organic Building Blocks;Sulfonyl Halides;Sulfur Compounds | | Mol File: | 832-53-1.mol |  |
| | PENTAFLUOROBENZENESULFONYL CHLORIDE Chemical Properties |
| Boiling point | 210-211 °C(lit.) | | density | 1.796 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.479(lit.) | | Fp | 195 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.797 | | Water Solubility | Soluble in water (reacts slowly). | | Sensitive | Moisture Sensitive | | BRN | 2142325 | | InChI | InChI=1S/C6ClF5O2S/c7-15(13,14)6-4(11)2(9)1(8)3(10)5(6)12 | | InChIKey | UOJCTEGNHXRPKO-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=C(F)C(F)=C(F)C(F)=C1F | | CAS DataBase Reference | 832-53-1(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-37 | | Safety Statements | 26-36/37/39-45-24/25 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 21 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | PENTAFLUOROBENZENESULFONYL CHLORIDE Usage And Synthesis |
| Chemical Properties | clear colourless to light yellow liquid | | Uses | Pentafluorobenzenesulfonyl chloride is used as derivatizing reagent for simultaneous determination of fluoxetine and p-trifluoromethylphenol, an O-dealkylated metabolite of fluoxetine in human liver microsomes. It is also used for electrophore labeling of small tyrosyl peptides for their analysis by gas chromatography with electron-capture detection. It is also employed as derivatizing reagent for amphetamine in determination of amphetamine in human plasma samples using gas chromatography with electron-capture detection. | | General Description | Pentafluorobenzenesulfonyl chloride reacts with benzene and thiophene derivatives in the presence of a ruthenium (II) catalyst to form corresponding perfluorophenylated compounds. | | Biochem/physiol Actions | Pentafluorobenzenesulfonyl chloride is derivatizing reagent for amphetamine in determination of amphetamine in human plasma samples using gas chromatography with electron-capture detectio. |
| | PENTAFLUOROBENZENESULFONYL CHLORIDE Preparation Products And Raw materials |
|