|
| 2-Chloro-3,4-difluoronitrobenzene Basic information |
Product Name: | 2-Chloro-3,4-difluoronitrobenzene | Synonyms: | 2-CHLORO-3,4-DIFLUORONITROBENZENE;2-Chloro-3,4-difluoro-1-nitrobenzene;2-Chloro-3,4,-difluoronitrobenzene 96%;2-Chloro-3,4,-difluoronitrobenzene96%;1-Chloro-2,3-difluoronitrobenzene;Benzene, 2-chloro-3,4-difluoro-1-nitro-;2,3-DIFLUORO-6-NITTROCHLOROBENZENE;3-chloro-1,2-difluoro-4-nitrobenzene | CAS: | 169468-83-1 | MF: | C6H2ClF2NO2 | MW: | 193.54 | EINECS: | | Product Categories: | Multisubstituted Benzene | Mol File: | 169468-83-1.mol |  |
| 2-Chloro-3,4-difluoronitrobenzene Chemical Properties |
Boiling point | 245.8±35.0 °C(Predicted) | density | 1.591±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | form | crystals | color | Amber/tan | InChI | InChI=1S/C6H2ClF2NO2/c7-5-4(10(11)12)2-1-3(8)6(5)9/h1-2H | InChIKey | MOKXBJZRTOPIFB-UHFFFAOYSA-N | SMILES | C1([N+]([O-])=O)=CC=C(F)C(F)=C1Cl | CAS DataBase Reference | 169468-83-1(CAS DataBase Reference) |
Hazard Codes | Xi | Hazard Note | Irritant | HS Code | 2904990090 |
| 2-Chloro-3,4-difluoronitrobenzene Usage And Synthesis |
| 2-Chloro-3,4-difluoronitrobenzene Preparation Products And Raw materials |
|