|
|
| | 3-Ethyl-1H-indole-2-carboxylic acid Basic information |
| | 3-Ethyl-1H-indole-2-carboxylic acid Chemical Properties |
| Boiling point | 402.3±25.0 °C(Predicted) | | density | 1.285±0.06 g/cm3(Predicted) | | pka | 4.03±0.30(Predicted) | | form | solid | | InChI | 1S/C11H11NO2/c1-2-7-8-5-3-4-6-9(8)12-10(7)11(13)14/h3-6,12H,2H2,1H3,(H,13,14) | | InChIKey | XOALTXJYIZPUCD-UHFFFAOYSA-N | | SMILES | O=C(O)C1=C(CC)C(C=CC=C2)=C2N1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Ethyl-1H-indole-2-carboxylic acid Usage And Synthesis |
| | 3-Ethyl-1H-indole-2-carboxylic acid Preparation Products And Raw materials |
|