| Company Name: |
Wuhan ChemFaces Biochemical Co., Ltd.
|
| Tel: |
18607101326 15172504745 |
| Email: |
aileen@chemfaces.com |
| Products Intro: |
Product Name:Clemastanin B
CAS:112747-98-5
Purity:>=98% Package:5mg ,10mg ,20mg ,50mg ,100mg; 200mg; 500mg,可根据客户需求定制 Remarks:2208/20mg
|
| Company Name: |
EMMX Biotechnology LLC
|
| Tel: |
888-539-0666 |
| Email: |
info@emmx.com |
| Products Intro: |
Product Name:Clemastanin B
CAS:112747-98-5
Purity:98% HPLC Package:5mg;10mg;25mg;50mg;100mg;250mg;500mg;1g
|
|
| | CLEMASTANIN B Basic information |
| Product Name: | CLEMASTANIN B | | Synonyms: | CLEMASTANIN B;Lariciresinol 4,4'-bis-O-beta-D-glucopyranoside;β-D-Glucopyranoside, 4-[(2S,3R,4R)-4-[[4-(β-D-glucopyranosyloxy)-3-methoxyphenyl]methyl]tetrahydro-3-(hydroxymethyl)-2-furanyl]-2-methoxyphenyl | | CAS: | 112747-98-5 | | MF: | C32H44O16 | | MW: | 684.68 | | EINECS: | | | Product Categories: | | | Mol File: | 112747-98-5.mol |  |
| | CLEMASTANIN B Chemical Properties |
| density | 1.478±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | -20°C | | solubility | water: slightly soluble | | form | Solid | | color | White to off-white | | biological source | plant | | Water Solubility | water: slightly soluble | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | PBLWZMSRSJTRHJ-NCIRKIHRSA-N | | SMILES | O1[C@@H]([C@H]([C@H](C1)Cc4cc(c(cc4)O[C@@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)CO)OC)CO)c2cc(c(cc2)O[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | CLEMASTANIN B Usage And Synthesis |
| Uses | Clemastanin B displays some inhibition to HSV virus. Also, it is found to inhibit different subtypes of human (H1N1, including swine-origin H1N1; H3N2 and influenza B) and avian influenza viruses (H6N2, H7N3, H9N2) at different magnitudes. | | Biological Activity | Clemastanin B has antioxidant and anti-inflammatory activities, it exerts its anti-influenza activity by inhibiting the virus multiplication, prophylaxsis and blocking the virus attachment. |
| | CLEMASTANIN B Preparation Products And Raw materials |
|