|
|
| | 5-CHLORO-2-(CHLOROMETHYL)PYRIDINE Basic information |
| Product Name: | 5-CHLORO-2-(CHLOROMETHYL)PYRIDINE | | Synonyms: | 5-CHLORO-2-(CHLOROMETHYL)PYRIDINE;2-ChloroMethyl-5-chloropyridine;Pyridine, 5-chloro-2-(chloroMethyl)-;5-chloro-pyridin-2-ylmethyl chloride;5-Chloro-2-(chloromethyl);CML-029;5-CHLORO-2-(CHLOROMETHYL)PYRIDINE ISO 9001：2015 REACH;KML-32 | | CAS: | 10177-24-9 | | MF: | C6H5Cl2N | | MW: | 162.02 | | EINECS: | | | Product Categories: | | | Mol File: | 10177-24-9.mol |  |
| | 5-CHLORO-2-(CHLOROMETHYL)PYRIDINE Chemical Properties |
| Boiling point | 48 °C | | density | 1.324±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 1.43±0.22(Predicted) | | form | liquid | | color | Colourless to red | | InChI | InChI=1S/C6H5Cl2N/c7-3-6-2-1-5(8)4-9-6/h1-2,4H,3H2 | | InChIKey | JTTKXEIHKDSIRC-UHFFFAOYSA-N | | SMILES | C1(CCl)=NC=C(Cl)C=C1 |
| HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 5-CHLORO-2-(CHLOROMETHYL)PYRIDINE Usage And Synthesis |
| Uses | As an intermediate, 5-chloro-2-(chloromethyl)pyridine is used in the
production of dyes and pigments, contributing to the development of new
colorants for various industries, including textiles, plastics, and
printing inks. |
| | 5-CHLORO-2-(CHLOROMETHYL)PYRIDINE Preparation Products And Raw materials |
|