|
|
| | 4'-(4-FLUOROBENZYLOXY)ACETOPHENONE Basic information |
| Product Name: | 4'-(4-FLUOROBENZYLOXY)ACETOPHENONE | | Synonyms: | BUTTPARK 52\14-91;4'-(4-FLUOROBENZYLOXY)ACETOPHENONE;4-(4-FLUOROBENZYLOXY)ACETOPHENONE;1-(4-[(4-FLUOROBENZYL)OXY]PHENYL)-1-ETHANONE;1-(4-[(4-FLUOROBENZYL)OXY]PHENYL)ETHANONE;1-(3-(4-fluorobenzyloxy)phenyl)ethanone;1-{4-[(4-fluorobenzyl)oxy]phenyl}ethan-1-one;4'-(4-Fluorobenzyloxy)acetophenone, 1-[(4-Acetylphenoxy)methyl]-4-fluorobenzene | | CAS: | 72293-96-0 | | MF: | C15H13FO2 | | MW: | 244.26 | | EINECS: | | | Product Categories: | | | Mol File: | 72293-96-0.mol |  |
| | 4'-(4-FLUOROBENZYLOXY)ACETOPHENONE Chemical Properties |
| Melting point | 79 °C | | Boiling point | 382.9±22.0 °C(Predicted) | | density | 1.163±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C15H13FO2/c1-11(17)13-4-8-15(9-5-13)18-10-12-2-6-14(16)7-3-12/h2-9H,10H2,1H3 | | InChIKey | MQJDMMIBGFVIDR-UHFFFAOYSA-N | | SMILES | CC(C1=CC=C(OCC2=CC=C(F)C=C2)C=C1)=O | | CAS DataBase Reference | 72293-96-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2914500090 | | Storage Class | 11 - Combustible Solids |
| | 4'-(4-FLUOROBENZYLOXY)ACETOPHENONE Usage And Synthesis |
| | 4'-(4-FLUOROBENZYLOXY)ACETOPHENONE Preparation Products And Raw materials |
|