1,9-BIS-BOC-1,5,9-TRIAZANONANE manufacturers
|
| | 1,9-BIS-BOC-1,5,9-TRIAZANONANE Basic information |
| Product Name: | 1,9-BIS-BOC-1,5,9-TRIAZANONANE | | Synonyms: | 1,9-BIS-BOC-1,5,9-TRIAZANONANE;Di-tert-butyl (azanediylbis(propane-3,1-diyl))dicarbamate;12-Oxa-2,6,10-triazatetradecanoic acid, 13,13-dimethyl-11-oxo-, 1,1-dimethylethyl ester;Bis(2-methyl-2-propanyl) (iminodi-3,1-propanediyl)biscarbamate;tert-butyl N-[3-[3-(tert-butoxycarbonylamino)propylamino]propyl]carbamate;i-tert-butyl (azanediylbis(propane-3,1-diyl))dicarbamate;tert-butyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]propyl]carbamate;bis[3-(t-butoxycarbonylamino)propyl]amine | | CAS: | 82409-02-7 | | MF: | C16H33N3O4 | | MW: | 331.45 | | EINECS: | | | Product Categories: | | | Mol File: | 82409-02-7.mol |  |
| | 1,9-BIS-BOC-1,5,9-TRIAZANONANE Chemical Properties |
| Melting point | 68.1-70.0 °C | | Boiling point | 467.3±30.0 °C(Predicted) | | density | 1.016±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 12.50±0.46(Predicted) | | form | Solid | | InChI | InChI=1S/C16H33N3O4/c1-15(2,3)22-13(20)18-11-7-9-17-10-8-12-19-14(21)23-16(4,5)6/h17H,7-12H2,1-6H3,(H,18,20)(H,19,21) | | InChIKey | RXUZRBQIVIUOLJ-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCCNCCCNC(=O)OC(C)(C)C |
| | 1,9-BIS-BOC-1,5,9-TRIAZANONANE Usage And Synthesis |
| Description | 1,9-Bis-Boc-1,5,9-triazanonane is a linker containing two Boc-protected amino groups. The Boc groups can be deprotected under mild acidic conditions to form the free amines. | | Chemical Properties | White powder | | Uses | 1,9-Bis-Boc-1,5,9-triazanonane is a linker containing two Boc-protected amino groups. The Boc groups can be deprotected under mild acidic conditions to form the free amines. |
| | 1,9-BIS-BOC-1,5,9-TRIAZANONANE Preparation Products And Raw materials |
|