|
|
| | 1H-1,2,3-Triazole, 5-nitro- Basic information |
| Product Name: | 1H-1,2,3-Triazole, 5-nitro- | | Synonyms: | Nitro-1,2,3-triazole;5-Nitro-1H-1,2,3-triazole;5-nitro-1H-triazole;4-Nitro-1H-1,2,3-triazole;1H-1,2,3-Triazole, 5-nitro- | | CAS: | 14544-45-7 | | MF: | C2H2N4O2 | | MW: | 114.06 | | EINECS: | | | Product Categories: | | | Mol File: | 14544-45-7.mol |  |
| | 1H-1,2,3-Triazole, 5-nitro- Chemical Properties |
| Melting point | 161-162℃ | | Boiling point | 356℃ | | density | 1.727 | | Fp | 169℃ | | storage temp. | Store at room temperature | | pka | 5.09±0.70(Predicted) | | form | solid | | color | Light yellow to yellow | | InChI | InChI=1S/C2H2N4O2/c7-6(8)2-1-3-5-4-2/h1H,(H,3,4,5) | | InChIKey | YXFWFUSVDJIVIV-UHFFFAOYSA-N | | SMILES | N1C([N+]([O-])=O)=CN=N1 |
| | 1H-1,2,3-Triazole, 5-nitro- Usage And Synthesis |
| | 1H-1,2,3-Triazole, 5-nitro- Preparation Products And Raw materials |
|