|
|
| | 4-Formyl-2-methoxyphenylboronic acid Basic information |
| | 4-Formyl-2-methoxyphenylboronic acid Chemical Properties |
| Melting point | 152-155 °C | | Boiling point | 400.7±55.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 7.37±0.58(Predicted) | | color | White to off-white | | InChI | InChI=1S/C8H9BO4/c1-13-8-4-6(5-10)2-3-7(8)9(11)12/h2-5,11-12H,1H3 | | InChIKey | PQECZCKVUFXDGP-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C=O)C=C1OC)(O)O |
| | 4-Formyl-2-methoxyphenylboronic acid Usage And Synthesis |
| Uses | 4-Formyl-2-methoxyphenylboronic Acid is used as a reactant in the identification of GDC-0810, an orally bioavailable selective estrogen receptor degrader that demonstrates activity in tamoxifen-resistant breast cancer xenografts. |
| | 4-Formyl-2-methoxyphenylboronic acid Preparation Products And Raw materials |
|