| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | benzyl 2-oxopiperidine-1-carboxylate Basic information |
| Product Name: | benzyl 2-oxopiperidine-1-carboxylate | | Synonyms: | benzyl 2-oxopiperidine-1-carboxylate;1-N-(Benzyloxycarbonyl)-2-piperidone;1-Piperidinecarboxylic acid, 2-oxo-, phenylmethyl ester;1-Z-2-Piperidone 95%;N-benzyloxycarbonyl-2-piperidone;Phenylmethyl 2-oxo-1-piperidinecarboxylate;1-Z-2-Piperidone | | CAS: | 106412-35-5 | | MF: | C13H15NO3 | | MW: | 233.26 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 106412-35-5.mol |  |
| | benzyl 2-oxopiperidine-1-carboxylate Chemical Properties |
| Boiling point | 416.3±24.0 °C(Predicted) | | density | 1.194 g/mL at 25 °C | | refractive index | n20/D1.544 | | Fp | >110℃ | | pka | -2.34±0.20(Predicted) | | form | liquid | | InChI | 1S/C13H15NO3/c15-12-8-4-5-9-14(12)13(16)17-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2 | | InChIKey | LKGMGCSFOUSKCR-UHFFFAOYSA-N | | SMILES | O=C1CCCCN1C(=O)OCc2ccccc2 |
| Risk Statements | 52/53 | | Safety Statements | 61 | | WGK Germany | 3 | | HS Code | 2933599590 | | Storage Class | 10 - Combustible liquids |
| | benzyl 2-oxopiperidine-1-carboxylate Usage And Synthesis |
| | benzyl 2-oxopiperidine-1-carboxylate Preparation Products And Raw materials |
|