| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Fmoc-Ile-OH-15N Basic information |
| Product Name: | Fmoc-Ile-OH-15N | | Synonyms: | Fmoc derivative;N-(9-Fluorenylmethoxycarbonyl)-L-isoleucine-15N;FMOC-L-ISOLEUCINE-15N;L-ISOLEUCINE-15N, FMOC DERIVATIVE;L-ISOLEUCINE-N-FMOC (15N);L-Isoleucine-15N, Fmoc derivative, N-(9-Fluorenylmethoxycarbonyl)-L-isoleucine-15N;FMOC-ILE-OH-15N;Fmoc-Ile-OH-1?N | | CAS: | 204633-89-6 | | MF: | C21H23NO4 | | MW: | 354.42 | | EINECS: | 276-255-9 | | Product Categories: | | | Mol File: | Mol File |  |
| | Fmoc-Ile-OH-15N Chemical Properties |
| Melting point | 145-147 °C (lit.) | | storage temp. | 2-8°C(protect from light) | | form | solid | | Major Application | peptide synthesis | | InChI | 1S/C21H23NO4/c1-3-13(2)19(20(23)24)22-21(25)26-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,13,18-19H,3,12H2,1-2H3,(H,22,25)(H,23,24)/t13-,19-/m0/s1/i22+1 | | InChIKey | QXVFEIPAZSXRGM-FYOZIULDSA-N | | SMILES | CC[C@H](C)[C@H]([15NH]C(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Ile-OH-15N Usage And Synthesis |
| | Fmoc-Ile-OH-15N Preparation Products And Raw materials |
|