(-)-MENTHYL CHLOROFORMATE manufacturers
|
| | (-)-MENTHYL CHLOROFORMATE Basic information |
| | (-)-MENTHYL CHLOROFORMATE Chemical Properties |
| Boiling point | 108-109 °C11 mm Hg(lit.) | | density | 1.031 g/mL at 20 °C(lit.) | | vapor pressure | 0.01 psi ( 20 °C) | | refractive index | n20/D 1.459 | | Fp | 158 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Sparingly) | | form | clear liquid | | color | Colorless to Almost colorless | | Optical Rotation | [α]20/D 83°, c = 1 in chloroform | | Sensitive | Moisture Sensitive | | BRN | 2414686 | | InChI | InChI=1S/C11H19ClO2/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 | | InChIKey | KIUPCUCGVCGPPA-KXUCPTDWSA-N | | SMILES | C(Cl)(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)=O | | CAS DataBase Reference | 14602-86-9(CAS DataBase Reference) |
| Hazard Codes | T,N | | Risk Statements | 23-34-51/53 | | Safety Statements | 26-36/37/39-45-61 | | RIDADR | UN 3277 6.1/PG 2 | | WGK Germany | 3 | | F | 10-19-21 | | HS Code | 2915.90.5010 | | HazardClass | 6.1 | | PackingGroup | II | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Inhalation
Skin Corr. 1B |
| | (-)-MENTHYL CHLOROFORMATE Usage And Synthesis |
| Uses | Readily forms a chloroimidodicarbonate which asymmetrically chlorinates silyl enol ethers under mild conditions and in good yields. |
| | (-)-MENTHYL CHLOROFORMATE Preparation Products And Raw materials |
|