|
|
| | Tert-butyl3-hydroxycyclopentylcarbamate Basic information |
| Product Name: | Tert-butyl3-hydroxycyclopentylcarbamate | | Synonyms: | Tert-butyl3-hydroxycyclopentylcarbamate;tert-butyl(3-hydroxycyclopentyl)catbaMte;tert-Butyl (3-hydroxycyclopentyl);tert-butyl N-(3-hydroxycyclopentyl)carbamate;N-Boc-3-aminocyclopentanol;3-N-Boc-aminocyclopentanol;Carbamic acid, N-(3-hydroxycyclopentyl)-, 1,1-dimethylethyl ester | | CAS: | 1154870-59-3 | | MF: | C10H19NO3 | | MW: | 201.26 | | EINECS: | | | Product Categories: | | | Mol File: | 1154870-59-3.mol |  |
| | Tert-butyl3-hydroxycyclopentylcarbamate Chemical Properties |
| Boiling point | 320.8±31.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.27±0.40(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-7-4-5-8(12)6-7/h7-8,12H,4-6H2,1-3H3,(H,11,13) | | InChIKey | SBUKINULYZANSP-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1CCC(O)C1 |
| | Tert-butyl3-hydroxycyclopentylcarbamate Usage And Synthesis |
| | Tert-butyl3-hydroxycyclopentylcarbamate Preparation Products And Raw materials |
|