|
|
| | Nsc97802 Basic information |
| Product Name: | Nsc97802 | | Synonyms: | Nsc97802;EthanediaMide, N,N'-bis(phenylMethyl)-;NSC 117519;NSC 314;N,N'-dibenzylethanediamide;Ethanediamide,N1,N2-bis(phenylmethyl)-;N,N'-Dibenzyl-oxalamide;N1,N2-Dibenzyloxalamide | | CAS: | 3551-78-8 | | MF: | C16H16N2O2 | | MW: | 268.31 | | EINECS: | | | Product Categories: | | | Mol File: | 3551-78-8.mol |  |
| | Nsc97802 Chemical Properties |
| Melting point | 221-223 °C | | density | 1.177±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 11.87±0.46(Predicted) | | form | powder | | Appearance | White to off-white Solid | | InChI | InChI=1S/C16H16N2O2/c19-15(17-11-13-7-3-1-4-8-13)16(20)18-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,19)(H,18,20) | | InChIKey | AOIKOYRULAZZLJ-UHFFFAOYSA-N | | SMILES | C(NCC1=CC=CC=C1)(=O)C(NCC1=CC=CC=C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Nsc97802 Usage And Synthesis |
| Uses | DBO is a ligand for the copper-catalyzed couplings of heteroanilines with (hetero)aryl halides. | | Synthesis Reference(s) | Journal of the American Chemical Society, 75, p. 4060, 1953 DOI: 10.1021/ja01112a055
Tetrahedron Letters, 26, p. 1079, 1985 DOI: 10.1016/S0040-4039(00)98517-4 |
| | Nsc97802 Preparation Products And Raw materials |
|