|
|
| | Platinum, dichloro(1,2-cyclohexanediamine-N,N')-, [sp-4-2-(1R-trans)]- Basic information |
| Product Name: | Platinum, dichloro(1,2-cyclohexanediamine-N,N')-, [sp-4-2-(1R-trans)]- | | Synonyms: | Oxaliplatin System Suitability (25 mg) ([SP-4-2-(1R-trans)]-(1,2-cyclohexanediamine-N,N') dichloridoplatinum(II));Nsc 265460;Nsc265460;Platinum, dichloro(1,2-cyclohexanediamine-N,N')-, (sp-4-2-(1R-trans))-;Platinum, dichloro(1,2-cyclohexanediamine-N,N')-, [sp-4-2-(1R-trans)]-;[SP-4-2-(1R-trans)]-(1,2-CyclohexanediaMine-N,N') DichloridoplatinuM(II);[SP-4-2-(1R-trans)]-(1,2-Cyclohexanediamine-N,N') dichlorideplatinum(II);Dichloro(1R,2R-cyclohexanediammine)platinum(II) | | CAS: | 61848-66-6 | | MF: | C6H12Cl2N2Pt | | MW: | 378.16 | | EINECS: | | | Product Categories: | | | Mol File: | 61848-66-6.mol | ![Platinum, dichloro(1,2-cyclohexanediamine-N,N')-, [sp-4-2-(1R-trans)]- Structure](CAS/20180713/GIF/61848-66-6.gif) |
| | Platinum, dichloro(1,2-cyclohexanediamine-N,N')-, [sp-4-2-(1R-trans)]- Chemical Properties |
| Melting point | >256°C (dec.) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly) | | form | Solid | | color | Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1/C6H12N2.2ClH.Pt/c7-5-3-1-2-4-6(5)8;;;/h5-8H,1-4H2;2*1H;/q-2;;;+4/p-2/t5-,6-;;;/s3 | | InChIKey | UUERTZXRKZEANK-SIGUBHPQNA-L | | SMILES | [Cl-][Pt+2]1(N[C@]2([H])CCCC[C@@]2([H])N1)[Cl-] |&1:3,9,r| |
| RIDADR | UN 3467 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2843900000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Carc. 2 Eye Irrit. 2 Muta. 1B Repr. 1B STOT RE 1 |
| | Platinum, dichloro(1,2-cyclohexanediamine-N,N')-, [sp-4-2-(1R-trans)]- Usage And Synthesis |
| Uses | [SP-4-2-(1R-trans)]-(1,2-Cyclohexanediamine-N,N’) dichloridoplatinum(II) is an impurity of Oxiplatin (O845075), third generation platinum complex. An antitumor agent with activity against colorectal cancer. Cytotoxicity follows the formation of adducts with DNA. Antineoplastic. |
| | Platinum, dichloro(1,2-cyclohexanediamine-N,N')-, [sp-4-2-(1R-trans)]- Preparation Products And Raw materials |
|