|
|
| | 1-tert-butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate Basic information |
| Product Name: | 1-tert-butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate | | Synonyms: | 1-tert-butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate;PKEYJCKTQWJLCD-UHFFFAOYSA-N;1-tert-butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate;1-O-tert-butyl 4-O-ethyl 4-formylpiperidine-1,4-dicarboxylate;1,4-Piperidinedicarboxylic acid, 4-formyl-, 1-(1,1-dimethylethyl) 4-ethyl ester;O1-tert-butyl O4-ethyl 4-formylpiperidine-1,4-dicarboxylate | | CAS: | 1253791-57-9 | | MF: | C14H23NO5 | | MW: | 285.34 | | EINECS: | | | Product Categories: | | | Mol File: | 1253791-57-9.mol |  |
| | 1-tert-butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate Chemical Properties |
| InChI | InChI=1S/C14H23NO5/c1-5-19-11(17)14(10-16)6-8-15(9-7-14)12(18)20-13(2,3)4/h10H,5-9H2,1-4H3 | | InChIKey | PKEYJCKTQWJLCD-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(C=O)(C(OCC)=O)CC1 |
| | 1-tert-butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate Usage And Synthesis |
| | 1-tert-butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate Preparation Products And Raw materials |
|