4-bromo-3,5-difluoropyridine manufacturers
|
| | 4-bromo-3,5-difluoropyridine Basic information |
| | 4-bromo-3,5-difluoropyridine Chemical Properties |
| Boiling point | 147.0±35.0 °C(Predicted) | | density | 1.808±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 1.10±0.10(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C5H2BrF2N/c6-5-3(7)1-9-2-4(5)8/h1-2H | | InChIKey | GUHHQICCMWFQAY-UHFFFAOYSA-N | | SMILES | C1=NC=C(F)C(Br)=C1F |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 29333990 |
| | 4-bromo-3,5-difluoropyridine Usage And Synthesis |
| | 4-bromo-3,5-difluoropyridine Preparation Products And Raw materials |
|