|
|
| | (-)-Irofulven Basic information |
| | (-)-Irofulven Chemical Properties |
| Melting point | 127-129° | | alpha | D25 -639° (c = 0.096 in ethanol) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Orange | | InChI | InChI=1S/C15H18O3/c1-8-6-10-12(11(8)7-16)9(2)15(4-5-15)14(3,18)13(10)17/h6,16,18H,4-5,7H2,1-3H3/t14-/m0/s1 | | InChIKey | NICJCIQSJJKZAH-AWEZNQCLSA-N | | SMILES | C12([C@](O)(C)C(=O)C3C(=C1C)C(CO)=C(C)C=3)CC2 |
| | (-)-Irofulven Usage And Synthesis |
| Uses | Semi-synrhetic antitumor agent derived from Illudin S. Inhibits DNA synthesis and induces apoptosis in tumor cells. Antineoplastic. | | Definition | ChEBI: Irofulven is a member of cyclohexenones. | | in vivo | (-)-Irofulven (7 mg/kg; i.p; on days 1-5 and 8-12) produces a statistically significant increase in the median survival of mice bearing tumor cells[2]. | Animal Model: | Male and female athymic BALB/c mice (nu/nu genotype, 6 weeks old or older) injected with human glioblastoma multiforme[2]. | | Dosage: | 7 mg/kg | | Administration: | i.p; on days 1-5 and 8-12 | | Result: | Was active against all tumor lines. |
|
| | (-)-Irofulven Preparation Products And Raw materials |
|