| Company Name: |
Varanous Labs Pvt Ltd
|
| Tel: |
+91-7036248882 |
| Email: |
bheemashankar.e@varanouslabs.com |
| Products Intro: |
Product Name:Enrofloxacin EP Impurity F CAS:131775-99-0 Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
Decarboxy Enrofloxacin manufacturers
|
| | Decarboxy Enrofloxacin Basic information |
| | Decarboxy Enrofloxacin Chemical Properties |
| Melting point | 157-158°C | | Boiling point | 489.9±45.0 °C(Predicted) | | density | 1.266±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform, Methanol | | form | Solid | | pka | 7.76±0.10(Predicted) | | color | Yellow | | Major Application | pharmaceutical small molecule | | InChI | 1S/C18H22FN3O/c1-2-20-7-9-21(10-8-20)17-12-16-14(11-15(17)19)18(23)5-6-22(16)13-3-4-13/h5-6,11-13H,2-4,7-10H2,1H3 | | InChIKey | MHZWALDGPXSPGF-UHFFFAOYSA-N | | SMILES | CCN(CC1)CCN1C2=C(F)C=C(C(C=CN3C4CC4)=O)C3=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Resp. Sens. 1 Skin Sens. 1 |
| | Decarboxy Enrofloxacin Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | Decarboxy Enrofloxacin (Enrofloxacin EP Impurity F) is an Enrofloxacin (E557800) impurity. | | Uses | Enrofloxacin (E557800) impurity. |
| | Decarboxy Enrofloxacin Preparation Products And Raw materials |
|