|
|
| | Glycidyl Palmitate Basic information |
| | Glycidyl Palmitate Chemical Properties |
| Melting point | 39-41C | | Boiling point | 170 °C(Press: 1 Torr) | | density | 0.8889 g/cm3(Temp: 60 °C) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C19H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(20)22-17-18-16-21-18/h18H,2-17H2,1H3 | | InChIKey | KYVUJPJYTYQNGJ-UHFFFAOYSA-N | | SMILES | C(OCC1CO1)(=O)CCCCCCCCCCCCCCC |
| | Glycidyl Palmitate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Glycidyl Palmitate is used for preparation of lysophosphatidic acids which inhibit apoptosis. | | Uses | Labelled Glycidyl Palmitate (G615950). Used for preparation of lysophosphatidic acids which inhibit apoptosis. |
| | Glycidyl Palmitate Preparation Products And Raw materials |
|