| Company Name: |
Yichang Zhongyitai Trading Co., Ltd. Gold
|
| Tel: |
0717-6449896 13886658719 |
| Email: |
root@zhongyitai.com |
| Products Intro: |
Product Name:Glycidyl Palmitate CAS:7501-44-2 Purity:99+% Package:10mg;100mg
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Glycidyl PalMitate CAS:7501-44-2 Package:100Mg,1g
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:Oxiran-2-ylmethyl palmitate CAS:7501-44-2 Purity:97% Package:100mg;250mg;1g Remarks:BD01295023
|
|
| | Glycidyl Palmitate Basic information |
| | Glycidyl Palmitate Chemical Properties |
| Melting point | 39-41?C | | Boiling point | 170 °C(Press: 1 Torr) | | density | 0.8889 g/cm3(Temp: 60 °C) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C19H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(20)22-17-18-16-21-18/h18H,2-17H2,1H3 | | InChIKey | KYVUJPJYTYQNGJ-UHFFFAOYSA-N | | SMILES | C(OCC1CO1)(=O)CCCCCCCCCCCCCCC |
| | Glycidyl Palmitate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Glycidyl Palmitate is used for preparation of lysophosphatidic acids which inhibit apoptosis. | | Uses | Labelled Glycidyl Palmitate (G615950). Used for preparation of lysophosphatidic acids which inhibit apoptosis. |
| | Glycidyl Palmitate Preparation Products And Raw materials |
|