6-(Phthalimidomethyl)morphanthridine manufacturers
- Epinastine Impurity 5
-
- $0.00 / 5mg
-
2025-12-19
- CAS:74860-00-7
- Min. Order: 5mg
- Purity: 95%+
- Supply Ability: 1000mg
|
| | 6-(Phthalimidomethyl)morphanthridine Basic information |
| Product Name: | 6-(Phthalimidomethyl)morphanthridine | | Synonyms: | 6-(Phthalimidomethyl)morphanthridine;2-(11H-Dibenz[b,e]azepin-6-ylMethyl)-1H-isoindole-1,3(2H)-dione;2-(11H-benzo[c][1]benzazepin-6-ylmethyl)isoindole-1,3-dione;2-((11H-Dibenzo[b,e]azepin-6-yl)methyl)isoindoline-1,3-dione;1H-Isoindole-1,3(2H)-dione, 2-(11H-dibenz[b,e]azepin-6-ylmethyl)-;Epinastine Impurity 12;2-(11H-dibenzo[b,e]azepin-6-ylmethyl)-1H-isoindole-1,3(2H)-dione;Epinastine Impurity 8/2-((11H-Dibenzo[b,e]azepin-6-yl)methyl)isoindoline-1,3-dione | | CAS: | 74860-00-7 | | MF: | C23H16N2O2 | | MW: | 352.39 | | EINECS: | 616-149-5 | | Product Categories: | Amines;Aromatics;Heterocycles;Intermediates | | Mol File: | 74860-00-7.mol |  |
| | 6-(Phthalimidomethyl)morphanthridine Chemical Properties |
| Melting point | 205.5-207.5 °C(Solv: dimethyl sulfoxide (67-68-5)) | | Boiling point | 521.7±50.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | solubility | Acetonitrile (Very Slightly), Chloroform (Slightly) | | form | Solid | | pka | 3.77±0.20(Predicted) | | color | Yellow | | InChI | InChI=1S/C23H16N2O2/c26-22-18-10-4-5-11-19(18)23(27)25(22)14-21-17-9-3-1-7-15(17)13-16-8-2-6-12-20(16)24-21/h1-12H,13-14H2 | | InChIKey | QAVFEJRLIYLUBJ-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CC1=NC2=CC=CC=C2CC2=CC=CC=C21 | | LogP | 3.6 at 20℃ |
| | 6-(Phthalimidomethyl)morphanthridine Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | 6-(Phthalimidomethyl)morphanthridine (cas# 74860-00-7) is a compound useful in organic synthesis. |
| | 6-(Phthalimidomethyl)morphanthridine Preparation Products And Raw materials |
|