- NVP-ACC789
-
- $45.00 / 10mg
-
2026-04-22
- CAS:300842-64-2
- Min. Order:
- Purity: 99.44%
- Supply Ability: 10g
|
| | N-(3-Bromo-4-methylphenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine Basic information |
| Product Name: | N-(3-Bromo-4-methylphenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine | | Synonyms: | ACC-789; ZK-202650; NVP-ACC-789;ACC789;ACC 789;N-(3-Bromo-4-methylphenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine;Acc-789;ZK 202650;NVP-ACC-789;ACC-789 (NVP-ACC789);N-(3-Bromo-4-methylphenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;NVP ACC789,Platelet-derived growth factor receptor,inhibit,ZK 202650,PDGFR,NVPACC789,Inhibitor,ZK-202650,ACC789,NVP-ACC789,VEGFR,ACC 789,NVP-ACC-789,Vascular endothelial growth factor receptor | | CAS: | 300842-64-2 | | MF: | C21H17BrN4 | | MW: | 405.29 | | EINECS: | | | Product Categories: | | | Mol File: | 300842-64-2.mol |  |
| | N-(3-Bromo-4-methylphenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine Chemical Properties |
| Boiling point | 607.7±55.0 °C(Predicted) | | density | 1.441 | | storage temp. | Store at -20°C | | solubility | DMSO:13.0(Max Conc. mg/mL);32.08(Max Conc. mM) DMF:0.5(Max Conc. mg/mL);1.23(Max Conc. mM) DMF:PBS (pH 7) (1:10):0.09(Max Conc. mg/mL);0.22(Max Conc. mM) Ethanol:0.2(Max Conc. mg/mL);0.49(Max Conc. mM) | | form | A crystalline solid | | pka | 5.46±0.10(Predicted) | | color | Light yellow to yellow | | InChI | InChI=1S/C21H17BrN4/c1-14-6-7-16(13-19(14)22)24-21-18-5-3-2-4-17(18)20(25-26-21)12-15-8-10-23-11-9-15/h2-11,13H,12H2,1H3,(H,24,26) | | InChIKey | GXWKSXUPEFVUOO-UHFFFAOYSA-N | | SMILES | C1(NC2=CC=C(C)C(Br)=C2)C2=C(C=CC=C2)C(CC2C=CN=CC=2)=NN=1 |
| | N-(3-Bromo-4-methylphenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine Usage And Synthesis |
| Uses | NVP-ACC789, is an inhibitor of human VEGFR-1, VEGFR-2 (mouse VEGFR-2), VEGFR-3 and PDGFR-β with IC50s of 0.38, 0.02 (0.23), 0.18, 1.4 μM, respectively. | | in vivo | NVP-ACC789 which is given in daily oral doses for 6 days blocks VEGF-induced angiogenesis in a dose-dependent manner. NVP-ACC789 also inhibits the response to bFGF to some extent, but the dose-response curve is not linear for NVP-ACC789[1]. | | IC 50 | VEGFR-2: 0.02 μM (IC50); VEGFR-1: 0.38 μM (IC50); mVEGFR-2: 0.23 μM (IC50); VEGFR-3: 0.18 μM (IC50); PDGFR-β: 1.4 μM (IC50) |
| | N-(3-Bromo-4-methylphenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine Preparation Products And Raw materials |
|