|
|
| | 8-Bromo-4-chloroquinoline-3-carboxylic acid ethyl ester Basic information |
| Product Name: | 8-Bromo-4-chloroquinoline-3-carboxylic acid ethyl ester | | Synonyms: | Ethyl 4-chloro-8-broMoquinoline-3-carboxylate;8-Bromo-4-chloroquinoline-3-carboxylic acid ethyl ester;8-Bromo-4-chloro-3-quinolinecarboxylic acid ethyl ester;3-Quinolinecarboxylic acid, 8-bromo-4-chloro-, ethyl ester;Ethyl8-bromo-4-chloroquinoline-3-carboxylate,97%;CAS:206258-97-1;ethyl 8-bromo-4-chloroquinoline-3-carboxylate - [E5351] | | CAS: | 206258-97-1 | | MF: | C12H9BrClNO2 | | MW: | 314.56 | | EINECS: | | | Product Categories: | | | Mol File: | 206258-97-1.mol |  |
| | 8-Bromo-4-chloroquinoline-3-carboxylic acid ethyl ester Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C12H9BrClNO2/c1-2-17-12(16)8-6-15-11-7(10(8)14)4-3-5-9(11)13/h3-6H,2H2,1H3 | | InChIKey | MLHAFVCMBUQWKC-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2Br)C(Cl)=C(C(OCC)=O)C=1 |
| WGK Germany | 3 | | HS Code | 2933499090 |
| | 8-Bromo-4-chloroquinoline-3-carboxylic acid ethyl ester Usage And Synthesis |
| Synthesis | General procedure for the synthesis of ethyl 4-chloro-8-bromoquinoline-3-carboxylate from ethyl 4-hydroxy-8-bromoquinoline-3-carboxylate: ethyl 8-bromo-4-hydroxyquinoline-3-carboxylate (2.0 g, 6.75 mmol) was dissolved in phosphorus triclosan (10 mL) and heated to reflux for 3 hr at 80 °C. Upon completion of the reaction, volatiles were removed by distillation under reduced pressure and the residue was quenched with ice water. The precipitated solid was collected by filtration and dried to give 1.8 g of the target product ethyl 4-chloro-8-bromoquinoline-3-carboxylate. The structure of the product was confirmed by 1H NMR (300 MHz, DMSO-d6) and mass spectrometry: 1H NMR δ 9.26 (s, 1H), 8.44-8.37 (m, 2H), 7.79-7.64 (t, J = 7.8 Hz, 1H), 4.48-4.43 (q, J = 7.2, 14.1 Hz, 2H), 1.41-1.36 (t. J = 6.9 Hz, 3H); MS (m/z): 314.01 (M + H)+. | | References | [1] Bioorganic and Medicinal Chemistry Letters, 2003, vol. 13, # 8, p. 1487 - 1490
[2] Patent: US2013/210844, 2013, A1. Location in patent: Paragraph 0338; 0339
[3] Patent: CN108623590, 2018, A. Location in patent: Paragraph 0149 |
| | 8-Bromo-4-chloroquinoline-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|