|
|
| | 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) Basic information | | Reaction |
| Product Name: | 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) | | Synonyms: | 1,3-BIS(DICYCLOHEXYLPHOSPHINO)PROPANE BIS(TETRAFLUOROBORATE;1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate);1,3-Bis(dicyclohexylphosphonium)propane bis(tetrafluoroborate), min. 97%;1,3-Bis(dicyclohexylphosphoniuM)propanebis(tetrafluoroborate),Min.97%;1,3-Bis(dicyclohexylphosphonium)propane bis(tetrafluoroborate);Propane-1,3-diylbis(dicyclohexylphosphonium) tetrafluoroborate;1,2-Bis(dicyclohexylphosphino)ethane bis(tetrafluoroborate);1,3-Bis(dicy | | CAS: | 1002345-50-7 | | MF: | C27H51BF4P2 | | MW: | 524.46 | | EINECS: | | | Product Categories: | Achiral Phosphine;Alkyl Phosphine;P-BF4;organophosphine ligand | | Mol File: | 1002345-50-7.mol |  |
| | 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) Chemical Properties |
| Melting point | 154-155℃ | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | white | | Stability: | hygroscopic | | InChI | InChI=1S/C27H50P2.BF4/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27;2-1(3,4)5/h24-27H,1-23H2;/q;-1/p+1 | | InChIKey | INPYFAGHRHZYDR-UHFFFAOYSA-O | | SMILES | [B+3]([F-])([F-])([F-])[F-].P(C1CCCCC1)(C1CCCCC1)CCCP(C1CCCCC1)C1CCCCC1.[H+] |
| Hazard Codes | Xn | | Risk Statements | 20/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) Usage And Synthesis |
| Reaction |
- Ligand for palladium-catalyzed carbonylation of aryl tosylates and mesylates.
- Ligand for palladium-catalyzed aminocarbonylation of aryl chlorides at atmospheric pressure
| | Uses |
1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) is a catalyst used in the preparation of silacarboxylic acids.
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) Preparation Products And Raw materials |
|