|
|
| | tert-butyl 4-(chloromethyl)piperidine-1-carboxylate Basic information |
| Product Name: | tert-butyl 4-(chloromethyl)piperidine-1-carboxylate | | Synonyms: | tert-butyl 4-(chloromethyl)piperidine-1-carboxylate;tert-Butyl 4-(chloromethyl)-1-piperidinecarboxylate;1-Boc-4-(chloromethyl)piperidine;1-Piperidinecarboxylic acid, 4-(chloromethyl)-, 1,1-dimethylethyl ester;N-Boc-4-chloromethylpiperidine | | CAS: | 479057-79-9 | | MF: | C11H20ClNO2 | | MW: | 233.74 | | EINECS: | | | Product Categories: | | | Mol File: | 479057-79-9.mol |  |
| | tert-butyl 4-(chloromethyl)piperidine-1-carboxylate Chemical Properties |
| Melting point | 49～51℃ | | Boiling point | 303.2±15.0 °C(Predicted) | | density | 1.076 | | storage temp. | 2-8°C | | form | Solid | | pka | -1.82±0.40(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C11H20ClNO2/c1-11(2,3)15-10(14)13-6-4-9(8-12)5-7-13/h9H,4-8H2,1-3H3 | | InChIKey | CTSABEXZMPJSGO-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(CCl)CC1 |
| | tert-butyl 4-(chloromethyl)piperidine-1-carboxylate Usage And Synthesis |
| | tert-butyl 4-(chloromethyl)piperidine-1-carboxylate Preparation Products And Raw materials |
|