| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | 3-Fluoro-4-methylene-1-piperidinecarboxylic acid tert-butyl ester Basic information |
| Product Name: | 3-Fluoro-4-methylene-1-piperidinecarboxylic acid tert-butyl ester | | Synonyms: | 3-Fluoro-4-methylene-1-piperidinecarboxylic acid tert-butyl ester;tert-butyl 3-fluoro-4-Methylidenepiperidine-1-carboxylate;1-Boc-3-fluoro-4-Methylenepiperidine;1-Piperidinecarboxylic acid, 3-fluoro-4-methylene-, 1,1-dimethylethyl ester;tert-butyl 1-[3-fluoro-4-methylenepiperidin-1-yl]carboxylate;tert-Butyl 3-fluoro-4-methylenepiperidin-1-carboxylate | | CAS: | 882033-92-3 | | MF: | C11H18FNO2 | | MW: | 215.26 | | EINECS: | | | Product Categories: | | | Mol File: | 882033-92-3.mol |  |
| | 3-Fluoro-4-methylene-1-piperidinecarboxylic acid tert-butyl ester Chemical Properties |
| Boiling point | 261℃ | | density | 1.06 | | Fp | 111℃ | | storage temp. | 2-8°C | | form | solid | | pka | -3.44±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C11H18FNO2/c1-8-5-6-13(7-9(8)12)10(14)15-11(2,3)4/h9H,1,5-7H2,2-4H3 | | InChIKey | FHMOJENFEWBNDZ-UHFFFAOYSA-N | | SMILES | FC1CN(C(OC(C)(C)C)=O)CCC1=C |
| HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Fluoro-4-methylene-1-piperidinecarboxylic acid tert-butyl ester Usage And Synthesis |
| | 3-Fluoro-4-methylene-1-piperidinecarboxylic acid tert-butyl ester Preparation Products And Raw materials |
|