|
|
| | PD 173952 Basic information |
| Product Name: | PD 173952 | | Synonyms: | PD 173952;6-(2,6-dichlorophenyl)-8-methyl-2-(4-morpholin-4-ylanilino)pyrido[2,3-d]pyrimidin-7-one;6-(2,6-Dichlorophenyl)-8-Methyl-2-[[4-(4-Morpholinyl)phenyl]aMino]pyrido[2,3-d]pyriMidin-7(8H)-one;6-(2,6-Dichloro-phenyl)-8-Methyl-2-(4-Morpholin-4-yl-phenylaMino)-8H-pyrido[2,3-d]pyriMidin-7-one;Pyrido[2,3-d]pyrimidin-7(8H)-one, 6-(2,6-dichlorophenyl)-8-methyl-2-[[4-(4-morpholinyl)phenyl]amino]-;6-(2,6-Dichlorophenyl)-8-methyl-2-((4-morpholinophenyl)amino)pyrido[2,3-d]pyrimidin-7(8H)-one;PD-173952PD-173952 | | CAS: | 305820-75-1 | | MF: | C24H21Cl2N5O2 | | MW: | 482.36 | | EINECS: | | | Product Categories: | Aromatics;Bases & Related Reagents;Heterocycles;Intermediates & Fine Chemicals;Nucleotides;Pfizer compounds;Pharmaceuticals;Tyrosine Kinase Inhibitors | | Mol File: | 305820-75-1.mol |  |
| | PD 173952 Chemical Properties |
| Melting point | >280oC (dec.) | | Boiling point | 693.0±65.0 °C(Predicted) | | density | 1.422±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: >10mg/mL | | pka | 5.79±0.40(Predicted) | | form | powder | | color | yellow to green | | InChI | 1S/C24H21Cl2N5O2/c1-30-22-15(13-18(23(30)32)21-19(25)3-2-4-20(21)26)14-27-24(29-22)28-16-5-7-17(8-6-16)31-9-11-33-12-10-31/h2-8,13-14H,9-12H2,1H3,(H,27,28,29) | | InChIKey | XZEJMVDCQZRHLN-UHFFFAOYSA-N | | SMILES | CN1C(=O)C(=Cc2cnc(Nc3ccc(cc3)N4CCOCC4)nc12)c5c(Cl)cccc5Cl |
| WGK Germany | nwg | | Storage Class | 11 - Combustible Solids |
| | PD 173952 Usage And Synthesis |
| Chemical Properties | Green Solid | | Uses | PD-173952 is a Bcr-Abl tyrosine kinase inhibitor used in treatment research for chronic myelegenous leukemia (CML). | | Uses | As a Bcr-Abl tyrosine kinase inhibitor, 6-(2,6-dichlorophenyl)-8-methyl-2-(4-morpholin-4-ylanilino)pyrido[2,3-d]pyrimidin-7-one can be used in treatment research for chronic myelegenous leukemia (CML). | | Biological Activity | PD173952 is a Src family kinase inhibitor. | | IC 50 | Lyn: 0.3 nM (IC50); Abl: 1.7 nM (IC50); Csk: 6.6 nM (IC50); Myt1: 8.1 nM (Ki); PKMYT1 |
| | PD 173952 Preparation Products And Raw materials |
|