| Company Name: |
Wuhan Topule Gold |
| Tel: |
+86-02787215551 19945035818 |
| Email: |
2936752263@qq.com |
- NH2-PEG9-acid
-
- $2.00
-
2026-08-25
- CAS:756526-04-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- NH2-PEG8-COOH
-
-
2026-07-31
- CAS:756526-04-2
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kgs
|
| | NH2-PEG8-COOH Basic information | | Purity |
| Product Name: | NH2-PEG8-COOH | | Synonyms: | Amino-PEG8-COOH;27-Amino-4,7,10,13,16,19,22,25-octaoxaheptacosanoic acid;alpha-aMine-oMega-propionic acid octaethylene glycol;Amino-PEG8-Acid;amino-dPEG 8-acid;Amino-PEG8-propionic acid;AMINE-PEG8-COOH;Amino-dPEG(R)8-acid | | CAS: | 756526-04-2 | | MF: | C19H39NO10 | | MW: | 441.51 | | EINECS: | | | Product Categories: | peg | | Mol File: | 756526-04-2.mol |  |
| | NH2-PEG8-COOH Chemical Properties |
| Boiling point | 547.1±50.0 °C(Predicted) | | density | 1.128±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | solid or viscous liquid | | pka | 4.28±0.10(Predicted) | | color | White to light yellow | | InChI | InChI=1S/C19H39NO10/c20-2-4-24-6-8-26-10-12-28-14-16-30-18-17-29-15-13-27-11-9-25-7-5-23-3-1-19(21)22/h1-18,20H2,(H,21,22) | | InChIKey | YLKOHZCQTVYVDB-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN |
| WGK Germany | WGK 3 | | HS Code | 2942000090 | | Storage Class | 11 - Combustible Solids |
| | NH2-PEG8-COOH Usage And Synthesis |
| Purity | ＞98% | | Description | Amino-PEG8-acid is a water soluble PEG linker consisting of an amino group (NH2) with a terminal carboxylic acid. The amine group is reactive with activated NHS esters, carbonyls (ketone, aldehyde) etc. | | Uses | 1-Amino-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic Acid is used in targeted drug delivery as conjugate with carbon nanotubes. It is also used as linker for enzyme immobilization in optimization of bio-nano interface to enhance enzyme catalytic efficiency. | | General Description | NH2-PEG8-COOH (also known as Amino-PEG8-Acid, NH2-PEG8-acid
CAS 756526-04-2) is a high-purity, monodisperse, water-soluble cross-linking reagent. This compound possesses a primary amine (-NH₂) at one end and a carboxylic acid (-COOH) at the other, linked by a hydrophilic octaethylene glycol spacer. The amine group is highly reactive with activated NHS esters, whilst the carboxyl group can undergo coupling reactions with primary amines via coupling agents such as EDC or HATU. | | reaction suitability | reagent type: cross-linking reagent
reactivity: carboxyl reactive | | IC 50 | Non-cleavable Linker; PEGs |
| | NH2-PEG8-COOH Preparation Products And Raw materials |
|