|
|
| | tert-butyl (3R,4R)-4-aMino-3-fluoropiperidine-1-carboxylate Basic information |
| Product Name: | tert-butyl (3R,4R)-4-aMino-3-fluoropiperidine-1-carboxylate | | Synonyms: | tert-butyl (3R,4R)-4-aMino-3-fluoropiperidine-1-carboxylate;(3R,4R)-4-AMino-1-Boc-3-fluoropiperidine;Trans-(3R,4R)-1-Boc-4-amino-3-fluoropiperidine;EOS-61545;1-Piperidinecarboxylic acid, 4-amino-3-fluoro-, 1,1-dimethylethyl ester, (3R,4R)-;(3R,4R)-1-Boc-4-amino-3-fluoropiperidine;tert-Butyl (3R,4R)-4-Fmino-3-fluoropiperidine-1-carboxylate | | CAS: | 1260612-08-5 | | MF: | C10H19FN2O2 | | MW: | 218.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1260612-08-5.mol |  |
| | tert-butyl (3R,4R)-4-aMino-3-fluoropiperidine-1-carboxylate Chemical Properties |
| Boiling point | 285.6±40.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 8.88±0.40(Predicted) | | Appearance | white solid | | InChI | 1S/C10H19FN2O2/c1-10(2,3)15-9(14)13-5-4-8(12)7(11)6-13/h7-8H,4-6,12H2,1-3H3/t7-,8-/m1/s1 | | InChIKey | ZQRYPCAUVKVMLZ-HTQZYQBOSA-N | | SMILES | O=C(OC(C)(C)C)N1C[C@@H](F)[C@H](N)CC1 |
| Storage Class | 11 - Combustible Solids |
| | tert-butyl (3R,4R)-4-aMino-3-fluoropiperidine-1-carboxylate Usage And Synthesis |
| | tert-butyl (3R,4R)-4-aMino-3-fluoropiperidine-1-carboxylate Preparation Products And Raw materials |
|