|
|
| | 2-(HYDROXYMETHYL)-1,3-PROPANEDIOL Basic information |
| Product Name: | 2-(HYDROXYMETHYL)-1,3-PROPANEDIOL | | Synonyms: | Propane, 1,3-dihydroxy-2-hydroxymethyl-;TRIS(HYDROXYMETHYL)METHANE;TRIMETHYLOLMETHANE;2-(hydroxymethyl)propane-1,3-diol;2-HYDROXYMETHYL-1,3-PROPANEDIOL, POLYME&;2-(HYDROXYMETHYL)-1,3-PROPANEDIOL 97+%;2-(HYDROXYMETHYL)-1,3-PROPANEDIOL;trihydroxymethylmethane | | CAS: | 4704-94-3 | | MF: | C4H10O3 | | MW: | 106.12 | | EINECS: | 225-187-8 | | Product Categories: | OLED | | Mol File: | 4704-94-3.mol |  |
| | 2-(HYDROXYMETHYL)-1,3-PROPANEDIOL Chemical Properties |
| Melting point | 63-68 °C (dec.) (lit.) | | Boiling point | 158 °C(Press: 1.5 Torr) | | density | 1.213±0.06 g/cm3(Predicted) | | Fp | 89 °C | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.10±0.10(Predicted) | | form | solid | | Appearance | Off-white to light yellow Solid | | BRN | 1733340 | | InChI | InChI=1S/C4H10O3/c5-1-4(2-6)3-7/h4-7H,1-3H2 | | InChIKey | SFRDXVJWXWOTEW-UHFFFAOYSA-N | | SMILES | C(O)C(CO)CO | | CAS DataBase Reference | 4704-94-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(HYDROXYMETHYL)-1,3-PROPANEDIOL Usage And Synthesis |
| Uses | 2-(Hydroxymethyl)propane-1,3-diol is a useful reactant for the preparation of tetracyanocyclopentadienide amine salts. | | Synthesis Reference(s) | Synthesis, p. 742, 1987 DOI: 10.1055/s-1987-28072 | | Synthesis | The general procedure for the synthesis of 2-hydroxymethyl-1,3-propanediol using the compound (CAS:113967-50-3) as starting material was as follows: the white powder (360 g, 0.86 mol) obtained in step (2) was dissolved in methanol (2L), followed by the addition of sodium methanolate (139 g, 2.58 mol). The reaction mixture was heated to reflux and kept for 20 hours. After completion of the reaction, the solvent was removed by evaporation. The residue was washed twice with chloroform and the organic phases were combined. The organic phase was dried over anhydrous sodium sulfate and concentrated. The concentrated product was crystallized in isobutanol to give 82 g of white powdered 2-hydroxymethyl-1,3-propanediol in 90% yield. | | References | [1] Synthesis, 1987, # 8, p. 742 - 744
[2] Patent: CN108440455, 2018, A. Location in patent: Paragraph 0066; 0076-0078; 0100; 0122 |
| | 2-(HYDROXYMETHYL)-1,3-PROPANEDIOL Preparation Products And Raw materials |
|