|
|
| | 5-Methyl-1H-indazole-6-boronic acid Basic information |
| Product Name: | 5-Methyl-1H-indazole-6-boronic acid | | Synonyms: | 5-Methyl-1H-indazole-6-boronic acid;6-Borono-5-methyl-1H-indazole;5-Methyl-1H-indazol-6-yl-6-boronic acid;(5-methyl-1H-indazol-6-yl)boronic acid;(5-Methyl-2H-indazol-6-yl)boronic acid;Boronic acid, B-(5-methyl-1H-indazol-6-yl)-;5-methyl-1H-indazole-6-boronic acid | | CAS: | 1310383-42-6 | | MF: | C8H9BN2O2 | | MW: | 175.98 | | EINECS: | | | Product Categories: | | | Mol File: | 1310383-42-6.mol |  |
| | 5-Methyl-1H-indazole-6-boronic acid Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C8H9BN2O2/c1-5-2-6-4-10-11-8(6)3-7(5)9(12)13/h2-4,12-13H,1H3,(H,10,11) | | InChIKey | FVSYCXICBAFOGW-UHFFFAOYSA-N | | SMILES | OB(O)C1=CC(NN=C2)=C2C=C1C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-Methyl-1H-indazole-6-boronic acid Usage And Synthesis |
| | 5-Methyl-1H-indazole-6-boronic acid Preparation Products And Raw materials |
|