| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | (7-Bromoheptyl)carbamic acid tert-butyl ester Basic information | | Uses |
| Product Name: | (7-Bromoheptyl)carbamic acid tert-butyl ester | | Synonyms: | (7-Bromoheptyl)carbamic acid tert-butyl ester;N-Boc-7-bromoheptan-1-amine;2-Methyl-2-propanyl (7-bromoheptyl)carbamate;Carbamic acid, N-(7-bromoheptyl)-, 1,1-dimethylethyl ester;1-(Boc-amino)-7-bromoheptane;tert-butyl N-(7-bromoheptyl)carbamate - [B82840];tert-Butyl (7-bromoheptyl)carbamate;tert-butyl N-(7-bromoheptyl)carbamate | | CAS: | 142356-34-1 | | MF: | C12H24BrNO2 | | MW: | 294.23 | | EINECS: | | | Product Categories: | | | Mol File: | 142356-34-1.mol |  |
| | (7-Bromoheptyl)carbamic acid tert-butyl ester Chemical Properties |
| Boiling point | 355℃ | | density | 1.166 | | Fp | 169℃ | | storage temp. | Store at room temperature | | pka | 12.93±0.46(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H24BrNO2/c1-12(2,3)16-11(15)14-10-8-6-4-5-7-9-13/h4-10H2,1-3H3,(H,14,15) | | InChIKey | VKBIPAHIGAUNSX-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCCCCCCBr |
| | (7-Bromoheptyl)carbamic acid tert-butyl ester Usage And Synthesis |
| Uses | (7-Bromoheptyl)carbamate tert-butyl ester is an organic intermediate that can be prepared by reducing 7-[(tert-butoxycarbonyl)amino]heptanoic acid to 7-[(tert-butoxycarbonyl)amino]heptanol, followed by bromination. |
| | (7-Bromoheptyl)carbamic acid tert-butyl ester Preparation Products And Raw materials |
|