|
|
| | 1-(4-Iodophenyl)-4-methylpiperazine Basic information |
| | 1-(4-Iodophenyl)-4-methylpiperazine Chemical Properties |
| Boiling point | 348.3±37.0 °C(Predicted) | | density | 1.550±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 7.71±0.42(Predicted) | | form | solid | | Appearance | Off-white to brown Solid | | InChI | 1S/C11H15IN2/c1-13-6-8-14(9-7-13)11-4-2-10(12)3-5-11/h2-5H,6-9H2,1H3 | | InChIKey | WHDKRPSSEZGGMR-UHFFFAOYSA-N | | SMILES | CN(CC1)CCN1C2=CC=C(I)C=C2 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 1-(4-Iodophenyl)-4-methylpiperazine Usage And Synthesis |
| | 1-(4-Iodophenyl)-4-methylpiperazine Preparation Products And Raw materials |
|