|
|
| | 2-Fluoro-4-(trans-propylcyclohexyl)phenyl boronic acid Basic information |
| Product Name: | 2-Fluoro-4-(trans-propylcyclohexyl)phenyl boronic acid | | Synonyms: | 2-Fluoro-4-(trans-propylcyclohexyl)phenyl boronic acid;(2-fluoro-4-((1s,4r)-4-propylcyclohexyl)phenyl)boronic acid;B-[2-Fluoro-4-(trans-4-propylcyclohexyl)phenyl]-boronic acid;2-Fluoro-4-(trans-4-propylcyclohexyl)phenylboronic acid;3-Fluoro-4'-(Trans-4-propylcyclohexyl)phenyl]-boronic acid;2-Fluoro-4-(trans-propylcyclohexyl);2-FLUORO-4-(TRANS-PROPYLCYCLOHEXYL)PHENYL BORONIC ACID PINACOL ESTER;Boronic acid, B-[2-fluoro-4-(trans-4-propylcyclohexyl)phenyl]- | | CAS: | 159119-10-5 | | MF: | C15H22BFO2 | | MW: | 264.14 | | EINECS: | 605-173-1 | | Product Categories: | | | Mol File: | 159119-10-5.mol |  |
| | 2-Fluoro-4-(trans-propylcyclohexyl)phenyl boronic acid Chemical Properties |
| Boiling point | 389.0±52.0 °C(Predicted) | | density | 1.09±0.1 g/cm3 (20 ºC 760 Torr) | | pka | 8.50±0.58(Predicted) | | InChI | InChI=1S/C15H22BFO2/c1-2-3-11-4-6-12(7-5-11)13-8-9-14(16(18)19)15(17)10-13/h8-12,18-19H,2-7H2,1H3/t11-,12- | | InChIKey | OZKQZVHMAGMWIN-HAQNSBGRSA-N | | SMILES | B(C1=CC=C([C@@H]2CC[C@@H](CCC)CC2)C=C1F)(O)O |
| | 2-Fluoro-4-(trans-propylcyclohexyl)phenyl boronic acid Usage And Synthesis |
| | 2-Fluoro-4-(trans-propylcyclohexyl)phenyl boronic acid Preparation Products And Raw materials |
|