|
|
| | Dicyclohexyl-3,4,3',4'-tetracarboxylic dianhydride Basic information |
| Product Name: | Dicyclohexyl-3,4,3',4'-tetracarboxylic dianhydride | | Synonyms: | Dicyclohexyl-3,4,3',4'-tetracarboxylic dianhydride;Dodecahydro-5,5'-bi-2-benzofuran-1,1',3,3'-tetrone;Dodecahydro-[5,5'-biisobenzofuran]-1,1',3,3'-tetraone;Bicyclohexyl-3,4,3',4'-tetracarboxylic
dianhydride;HBPDA;5,5'-Biisobenzofuran]-1,1',3,3'-tetrone, dodecahydro-;Dicyclohexyl-3;4-tetracarboxylic dianhydride | | CAS: | 122640-83-9 | | MF: | C16H18O6 | | MW: | 306.31 | | EINECS: | | | Product Categories: | | | Mol File: | 122640-83-9.mol |  |
| | Dicyclohexyl-3,4,3',4'-tetracarboxylic dianhydride Chemical Properties |
| Melting point | 208 °C | | Boiling point | 544.0±50.0 °C(Predicted) | | density | 1.372±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C16H18O6/c17-13-9-3-1-7(5-11(9)15(19)21-13)8-2-4-10-12(6-8)16(20)22-14(10)18/h7-12H,1-6H2 | | InChIKey | SNHKMHUMILUWSJ-UHFFFAOYSA-N | | SMILES | C1(=O)C2C(CC(C3CCC4C(=O)OC(=O)C4C3)CC2)C(=O)O1 |
| | Dicyclohexyl-3,4,3',4'-tetracarboxylic dianhydride Usage And Synthesis |
| Chemical Properties | off-white crystalline powder | | Chemical Properties | Dicyclohexyl-3,4,3',4'-tetracarboxylic dianhydride (HBPDA) is a dianhydride building block with a flexible bicyclohexyl core. The polyimides synthesized form dicyclohexyl-3,4,3',4'-tetracarboxylic dianhydride are often transparent, because of the flexible polymer backbones. Thus, it can be used as shielding layers in photovoltaics. The refractive index of the polyimides can be tuned by TiO2 fillers for matching the ZnO layer (the electron transport layer), to reduce the reflection losses at the ZnO interface. | | Uses | HBPDA is a polyimide precursor that is used to prepare polyimides by reaction with diamines and dianhydrides. And it is used in the formation of coatings on various materials including metals and plastics. |
| | Dicyclohexyl-3,4,3',4'-tetracarboxylic dianhydride Preparation Products And Raw materials |
|