|
|
| | Ethanol, 2-[(2,6-dichlorophenyl)Methoxy]- Basic information |
| Product Name: | Ethanol, 2-[(2,6-dichlorophenyl)Methoxy]- | | Synonyms: | Ethanol, 2-[(2,6-dichlorophenyl)Methoxy]-;2-((2,6-dichlorobenzyl)oxy)ethan-1-ol;2-[(2,6-Dichlorobenzyl)oxy]ethanol;2-[(2,6-Dichlorobenzyl)oxy]ethane;BNKY020-VT05;(2, 6-Dichlorobenzyl) Oxy]Ethanol;2-[(2,6-Dichlorophenyl)methoxy]-ethanol;2-(2,6-Dichlorobenzyloxy)ethanolQ: What is
2-(2,6-Dichlorobenzyloxy)ethanol Q: What is the CAS Number of
2-(2,6-Dichlorobenzyloxy)ethanol | | CAS: | 85309-91-7 | | MF: | C9H10Cl2O2 | | MW: | 221.08 | | EINECS: | 617-700-2 | | Product Categories: | Intermediate;85309-91-7 | | Mol File: | 85309-91-7.mol | ![Ethanol, 2-[(2,6-dichlorophenyl)Methoxy]- Structure](CAS/20150408/GIF/85309-91-7.gif) |
| | Ethanol, 2-[(2,6-dichlorophenyl)Methoxy]- Chemical Properties |
| Boiling point | 318.8±32.0 °C(Predicted) | | density | 1.327±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 14.30±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H10Cl2O2/c10-8-2-1-3-9(11)7(8)6-13-5-4-12/h1-3,12H,4-6H2 | | InChIKey | MCVIDUDFKDIJMZ-UHFFFAOYSA-N | | SMILES | C(O)COCC1=C(Cl)C=CC=C1Cl |
| RIDADR | UN1759 | | HazardClass | 8 |
| | Ethanol, 2-[(2,6-dichlorophenyl)Methoxy]- Usage And Synthesis |
| | Ethanol, 2-[(2,6-dichlorophenyl)Methoxy]- Preparation Products And Raw materials |
|