|
|
| | 3-Boc-6-oxo-3-aza-bicyclo[3.1.1]heptane Basic information |
| Product Name: | 3-Boc-6-oxo-3-aza-bicyclo[3.1.1]heptane | | Synonyms: | 2-methyl-2-propanyl 6-oxo-3-azabicyclo[3.1.1]heptane-3-carboxylat E;6-Oxo-3-aza-bicyclo[3.1.1]heptane-3-carboxylic acid tert-butyl ester;3-Boc-6-oxo-3-aza-bicyclo[3.1.1]heptane;3-Boc-6-oxo-3-aza-bicyclo...;3-Boc-3-azabicyclo[3.1.1]heptan-6-one;3-Azabicyclo[3.1.1]heptane-3-carboxylic acid, 6-oxo-, 1,1-dimethylethyl ester;2-Methyl-2-propanyl 6-oxo-3-azabicyclo[3.1.1]heptane-3-carbo... | | CAS: | 1251013-26-9 | | MF: | C11H17NO3 | | MW: | 211.26 | | EINECS: | | | Product Categories: | | | Mol File: | 1251013-26-9.mol | ![3-Boc-6-oxo-3-aza-bicyclo[3.1.1]heptane Structure](CAS/GIF/1251013-26-9.gif) |
| | 3-Boc-6-oxo-3-aza-bicyclo[3.1.1]heptane Chemical Properties |
| Boiling point | 308.2±35.0 °C(Predicted) | | density | 1.173±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -1.58±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H17NO3/c1-11(2,3)15-10(14)12-5-7-4-8(6-12)9(7)13/h7-8H,4-6H2,1-3H3 | | InChIKey | HYSWAZRVGXDNQF-UHFFFAOYSA-N | | SMILES | C12CC(C1=O)CN(C(OC(C)(C)C)=O)C2 |
| | 3-Boc-6-oxo-3-aza-bicyclo[3.1.1]heptane Usage And Synthesis |
| Uses | tert-Butyl 6-Oxo-3-azabicyclo[3.1.1]heptane-3-carboxylate may be useful in the preparation of macrocyclic compounds as modulators of cystic fibrosis transmembrane conductance regulator. |
| | 3-Boc-6-oxo-3-aza-bicyclo[3.1.1]heptane Preparation Products And Raw materials |
|