|
|
| | (S)-(-)-ALPHA-METHYL-2-NAPHTHALENEMETHANOL Basic information |
| | (S)-(-)-ALPHA-METHYL-2-NAPHTHALENEMETHANOL Chemical Properties |
| Melting point | 70-71 °C | | Boiling point | 103 °C(Press: 0.3 Torr) | | density | 1.113 | | refractive index | -38 ° (C=1, MeOH) | | pka | 14.36±0.20(Predicted) | | Optical Rotation | [α]20/D 40°, c = 5 in ethanol | | BRN | 2042396 | | InChI | InChI=1/C12H12O/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h2-9,13H,1H3/t9-/s3 | | InChIKey | AXRKCRWZRKETCK-DJEYLCQNNA-N | | SMILES | [C@H](C1C=CC2=CC=CC=C2C=1)(O)C |&1:0,r| | | CAS DataBase Reference | 27544-18-9(CAS DataBase Reference) |
| | (S)-(-)-ALPHA-METHYL-2-NAPHTHALENEMETHANOL Usage And Synthesis |
| Uses | (S)-(-)-1-(2-Naphthyl)ethanol is a useful biochemical for proteomics research. |
| | (S)-(-)-ALPHA-METHYL-2-NAPHTHALENEMETHANOL Preparation Products And Raw materials |
|