|
|
| | 9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine Basic information |
| Product Name: | 9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine | | Synonyms: | 9-(4-ACETOXY-3-ACETOXYMETHYLBUT-1-YL)-2-AMINO-6-CHLOROPURINE;9-[4-Acetoxy-3-(acetoxymethyl)butyl]-2-amino-6-chl;9-(4-ACETOXY-3-ACETOXYMETHYLBUT-1-YL)-2-AMINO-6-CHLOROPUINE;9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine;1,3-Propanediol,2-[2-(2-amino-6-chloro-9H-purin-9-yl)ethyl]diacetate(ester)(9Cl;9-(4-Acetoxy-3-aceto;2-(2-(2-AMino-6-chloro-9H-purin-9-yl)ethyl)propane-1,3-diyl diacetate;9-(4-ACETOXY-3)-ACETOXYMETHYLBURYL-2-AMINO-6-CHLOROPURINE | | CAS: | 97845-60-8 | | MF: | C14H18ClN5O4 | | MW: | 355.78 | | EINECS: | 619-293-7 | | Product Categories: | API intermediates | | Mol File: | 97845-60-8.mol |  |
| | 9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine Chemical Properties |
| Melting point | 132-134 °C(Solv: isopropanol (67-63-0)) | | Boiling point | 575.0±60.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 2.23±0.10(Predicted) | | form | Solid | | color | Off-White to Light Yellow | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C14H18ClN5O4/c1-8(21)23-5-10(6-24-9(2)22)3-4-20-7-17-11-12(15)18-14(16)19-13(11)20/h7,10H,3-6H2,1-2H3,(H2,16,18,19) | | InChIKey | KXPSHSVVYGZKAV-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)C(CCN1C2C(N=C1)=C(Cl)N=C(N)N=2)COC(=O)C | | LogP | 0.92 at 25℃ and pH9.1 | | CAS DataBase Reference | 97845-60-8(CAS DataBase Reference) |
| | 9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine Usage And Synthesis |
| Uses | 9-[4-Acetoxy-3-(acetoxymethyl)butyl]-2-amino-6-chloropurine is an impurity of Famciclovir (F101125), an antiviral agent and a prodrug of Penciclovir (P221500). | | Synthesis | 9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine through a four-step synthesis: steps. 1) Preparation of 1,3-diacetoxy-2-bromopropane: 1,3-Dichloro-2-propanol reacts with potassium acetate and ammonium chloride in DMF. After work-up and reaction with triethylamine hydrobromide, distillation yields the product. 2) Preparation of the zinc reagent: 1,3-Diacetoxy-2-bromopropane reacts with zinc powder and anhydrous lithium bromide in THF, initiated by TMSCl. 3) Preparation of the catalyst: Palladium acetate and S-Phos are stirred in THF under nitrogen. 4) Preparation of the final product: 2-Amino-6-chloro-9-bromoethylpurine, the freshly prepared catalyst, and the zinc reagent react in THF. Work-up and recrystallization from ethanol yield the product. |
| | 9-(4-Acetoxy-3-acetoxymethylbutyl)-2-amino-6-chloropurine Preparation Products And Raw materials |
|