Ethyl 7-chloroindole-2-carboxylate manufacturers
|
| | Ethyl 7-chloroindole-2-carboxylate Basic information |
| | Ethyl 7-chloroindole-2-carboxylate Chemical Properties |
| Melting point | 105 °C | | Boiling point | 375.0±22.0 °C(Predicted) | | density | 1.329±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 13.43±0.30(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H10ClNO2/c1-2-15-11(14)9-6-7-4-3-5-8(12)10(7)13-9/h3-6,13H,2H2,1H3 | | InChIKey | HPDPSWAIDXFYTE-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2Cl)C=C1C(OCC)=O |
| | Ethyl 7-chloroindole-2-carboxylate Usage And Synthesis |
| Uses | Ethyl 7-chloroindole-2-carboxylate is an organic synthesis intermediate, mainly used in the synthesis of drugs and pesticide molecules containing indole rings, and is also an important component in chemical research. | | Synthesis | General procedure for the synthesis of ethyl 7-chloro-1H-indole-2-carboxylate from the compound (CAS:115050-49-2): 500 g of polyphosphoric acid and 250 g of phosphoric acid were mixed, stirred and heated up to 90°C. Under stirring conditions, 65 g of phenylhydrazine 2-chlorophenylpyruvate pyruvic acid was slowly added and the temperature of the reaction was controlled to be between 90°C and 100°C. The reaction took about 1 hour. The dosing process takes about 1 hour. After completion of dosing, the reaction temperature was maintained to continue the reaction for 20 minutes and the reaction progress was monitored by TLC. Upon completion of the reaction, 1500 g of ice-water mixture was slowly added to quench the reaction and cooled to room temperature. The precipitate was collected by filtration, washed with water and dried to give a light yellow solid product. Upon drying, 51.3 g of ethyl 7-chloro-1H-indole-2-carboxylate was obtained in 85% yield. | | References | [1] Patent: CN104402795, 2017, B. Location in patent: Paragraph 0060; 0062 |
| | Ethyl 7-chloroindole-2-carboxylate Preparation Products And Raw materials |
|