|
|
| | TRIS(3,5-DIMETHYLPHENYL)PHOSPHINE Basic information |
| Product Name: | TRIS(3,5-DIMETHYLPHENYL)PHOSPHINE | | Synonyms: | tris(3,5-dimethylphenyl)-phosphin;TRIS(3,5-DIMETHYLPHENYL)PHOSPHINE;TRIS(3,5-XYLYL)PHOSPHINE;TRI(3,5-XYLYL)PHOSPHINE;Tris(3,5-dimethylphenyl)phosphine,98%;TRIS(3,5-DIMETHYLPHENYL)PHOSPHINE, 97+%;Tri(3,5-dimethylphenyl)phosphine;Tris(3,5-dimethylphenyl)phosphineTris(3,5-xylyl)phosphine | | CAS: | 69227-47-0 | | MF: | C24H27P | | MW: | 346.44 | | EINECS: | 624-162-2 | | Product Categories: | Aryl Phosphine;Achiral Phosphine;organophosphorus ligand;Ligand;Catalysis and Inorganic Chemistry;Phosphine Ligands;Phosphorus Compounds | | Mol File: | 69227-47-0.mol |  |
| | TRIS(3,5-DIMETHYLPHENYL)PHOSPHINE Chemical Properties |
| Melting point | 160-165 °C | | Boiling point | 474.1±45.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | crystal | | color | white | | InChI | 1S/C24H27P/c1-16-7-17(2)11-22(10-16)25(23-12-18(3)8-19(4)13-23)24-14-20(5)9-21(6)15-24/h7-15H,1-6H3 | | InChIKey | XRALRSQLQXKXKP-UHFFFAOYSA-N | | SMILES | Cc1cc(C)cc(c1)P(c2cc(C)cc(C)c2)c3cc(C)cc(C)c3 | | EPA Substance Registry System | Phosphine, tris(3,5-dimethylphenyl)- (69227-47-0) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 26-36/37/39-22 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ACROS
| English |
| | TRIS(3,5-DIMETHYLPHENYL)PHOSPHINE Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Catalyst for:
- Cu / diphosphine-catalyzed asymmetric hydrogenation of heteroaromatic ketones and enones
- Highly selective rhodium-catalyzed hydrogenation reactions
- Classical versus kinetic resolution in preparation of privileged silicon-stereogenic silanaphthalenes
Used for kinetic resolution of donor-functionalized secondary alcohols via Cu-H-catalyzed stereoselective silylation by dehydrogenative Si-O coupling with Si-stereogenic silanes
Used for comparative studies of conformational rigidity of silicon-stereogenic silanes in asymmetric catalysis | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | TRIS(3,5-DIMETHYLPHENYL)PHOSPHINE Preparation Products And Raw materials |
|