3-chloro-5-iodophenol manufacturers
- 3-chloro-5-iodophenol
-
- $0.00 / 1kg
-
2025-04-04
- CAS:861347-86-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
|
| | 3-chloro-5-iodophenol Basic information |
| | 3-chloro-5-iodophenol Chemical Properties |
| Melting point | 60℃ | | Boiling point | 301.5±27.0 °C(Predicted) | | density | 2.087 | | storage temp. | 2-8°C(protect from light) | | pka | 8.15±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C6H4ClIO/c7-4-1-5(8)3-6(9)2-4/h1-3,9H | | InChIKey | QBNIBNUEBBJVFN-UHFFFAOYSA-N | | SMILES | C1(O)=CC(I)=CC(Cl)=C1 |
| | 3-chloro-5-iodophenol Usage And Synthesis |
| Safety | 3-Chloro-5-iodophenol is a versatile reagent that can be seamlessly integrated into various applications, from pharmaceuticals to agrochemicals. However, handle it with care, as it may cause skin irritation, eye irritation, and respiratory discomfort. Always store in a cool, well-ventilated area and wear appropriate protective gear when working with this compound. |
| | 3-chloro-5-iodophenol Preparation Products And Raw materials |
|