|
|
| | Benzyl alcohol (ring-13C6) Basic information |
| Product Name: | Benzyl alcohol (ring-13C6) | | Synonyms: | Benzyl alcohol (phenyl-13C6);Benzyl-13C6 alcohol (ring-13C6);Benzyl alcohol-(phenyl-3C6)
;Benzyl-13C6 Alcohol;13C6]-Benzyl alcohol;Benzyl alcohol-(phenyl-3C6);Benzyl alcohol (ring-13C?, 99%);Benzyl alcohol (ring-13C6) | | CAS: | 201740-95-6 | | MF: | C7H8O | | MW: | 114.19 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Benzyl alcohol (ring-13C6) Chemical Properties |
| Melting point | -16--13 °C(lit.) | | Boiling point | 203-205 °C(lit.) | | density | 1.102 g/mL at 25 °C | | Fp | 96 °C | | InChI | 1S/C7H8O/c8-6-7-4-2-1-3-5-7/h1-5,8H,6H2/i1+1,2+1,3+1,4+1,5+1,7+1 | | InChIKey | WVDDGKGOMKODPV-ZXJNGCBISA-N | | SMILES | OC[13c]1[13cH][13cH][13cH][13cH][13cH]1 | | CAS Number Unlabeled | 100-51-6 |
| Hazard Codes | Xn | | Risk Statements | 20/22 | | Safety Statements | 26 | | WGK Germany | 1 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2 |
| | Benzyl alcohol (ring-13C6) Usage And Synthesis |
| Uses | Benzyl alcohol-13C6 is the 13C labeled Benzyl alcohol[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110 |
| | Benzyl alcohol (ring-13C6) Preparation Products And Raw materials |
|