2-broMo-4,4'-di-tert-butylbiphenyl manufacturers
|
| | 2-broMo-4,4'-di-tert-butylbiphenyl Basic information |
| Product Name: | 2-broMo-4,4'-di-tert-butylbiphenyl | | Synonyms: | 2-Bromo-4,4'-di-tert-butyl-1,1'-biphenyl;2-broMo-4,4'-di-tert-butylbiphenyl;1,1'-Biphenyl,2-bromo-4,4'-bis(1,1-dimethylethyl)-;2-bromo-4-tert-butyl-1-(4-tert-butylphenyl)benzene;2-Bromo-4,4'-bis(1,1-dimethylethyl)-1,1'-biphenyl;(R)-1-[(1s)-2-(dicyclohexylphosphino)ferrocenyl;1,1'-Biphenyl, 2-bromo-4,4'-bis(1,1-dimethylethyl)-;-Biphenyl, 2-bromo-4,4' | | CAS: | 70728-89-1 | | MF: | C20H25Br | | MW: | 345.32 | | EINECS: | | | Product Categories: | | | Mol File: | 70728-89-1.mol |  |
| | 2-broMo-4,4'-di-tert-butylbiphenyl Chemical Properties |
| Melting point | 89.4-90.9 °C(Solv: ethanol (64-17-5)) | | Boiling point | 367.5±11.0 °C(Predicted) | | density | 1.134±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C20H25Br/c1-19(2,3)15-9-7-14(8-10-15)17-12-11-16(13-18(17)21)20(4,5)6/h7-13H,1-6H3 | | InChIKey | OPPSYCGZHQVDPM-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C(C)(C)C)C=C2)=CC=C(C(C)(C)C)C=C1Br |
| | 2-broMo-4,4'-di-tert-butylbiphenyl Usage And Synthesis |
| Uses | 2-bromo-4,4'-di-tert-butylbiphenyl is an important compound used in electronic devices. |
| | 2-broMo-4,4'-di-tert-butylbiphenyl Preparation Products And Raw materials |
|