| Company Name: |
KARPSCHEM LABORATORIES
|
| Tel: |
+91-7249203006 |
| Email: |
info@karpschem.in |
| Products Intro: |
Product Name:Nifedipine EP impurity C
methyl 2-(2-nitrobenzylidene)-3-oxobutanoate
CAS:111304-31-5
Purity:96% Package:25 mg, 50 mg , 100mg or 500 mg
|
| Company Name: |
S.Z. PhyStandard Bio-Tech. Co., Ltd.
|
| Tel: |
0755-4000505016 13380397412 |
| Email: |
3001272453@qq.com |
| Products Intro: |
Product Name:Nifedipine Impurity C
CAS:111304-31-5
Purity:98% HPLC Package:10mg;25mg;50mg;100mg
|
|
| | nifedipine iMpurity C Basic information |
| Product Name: | nifedipine iMpurity C | | Synonyms: | nifedipine iMpurity C;Nifedipine impurity C (EP);APKKCRAKPMSAEI-YFHOEESVSA-N;2'-nitrobenzylideneacetoacetic acid methyl ester;Butanoic acid, 2-[(2-nitrophenyl)methylene]-3-oxo-, methyl ester, (2Z)-;Methyl 2-[(2-Nitrophenyl)methylidene]-3-oxobutanoate;Nifedipine Impurity 56;(Z)-Methyl 2-(2-nitrobenzylidene)-3-oxobutanoate (Nifedipine Impurity) | | CAS: | 111304-31-5 | | MF: | C12H11NO5 | | MW: | 249.22 | | EINECS: | | | Product Categories: | | | Mol File: | 111304-31-5.mol |  |
| | nifedipine iMpurity C Chemical Properties |
| Melting point | 90-93 °C(Solv: ethyl acetate (141-78-6); hexane (110-54-3)) | | Boiling point | 395.9±32.0 °C(Predicted) | | density | 1.296±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C12H11NO5/c1-8(14)10(12(15)18-2)7-9-5-3-4-6-11(9)13(16)17/h3-7H,1-2H3/b10-7- | | InChIKey | APKKCRAKPMSAEI-YFHOEESVSA-N | | SMILES | C(OC)(=O)/C(=C\C1=CC=CC=C1[N+]([O-])=O)/C(=O)C |
| | nifedipine iMpurity C Usage And Synthesis |
| Uses | Methyl 2-[(2-nitrophenyl)methylidene]-3-oxobutanoate is an impurity compound of Nifedipine (N457000). Nifedipine is an antihypertensive and antianginal. A dihydorpyridine calcium channel blocker. |
| | nifedipine iMpurity C Preparation Products And Raw materials |
|